Products 196597-69-0
CAS 196597-69-0 appears in our catalog under these names: Ramelteon Impurity L, 4-Bromo-1,2,6,7-tetrahydro-8H-indeno[5,4-b]furan-8-one, 95%, Ramelteon Impurity 34. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-bromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one (CAS 196597-69-0) is a chemical compound with the molecular formula C11H9BrO2 and a molecular weight of 253.09 g/mol. IUPAC name: 4-bromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one. InChIKey: ZBSNWNPYUYBSDK-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2 |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 4-bromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one |
| InChIKey | ZBSNWNPYUYBSDK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C3CCOC3=C(C=C21)Br |
Computed by PubChem (NCBI)