Products 2364584-67-6
CAS 2364584-67-6 appears in our catalog under these names: Prop-2-yn-1-yl 4-bromo-3-methylbenzoate, 95%, Prop-2-yn-1-yl 4-bromo-3-methylbenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 100g, 5g, 1g.
Prop-2-ynyl 4-bromo-3-methylbenzoate (CAS 2364584-67-6) is a chemical compound with the molecular formula C11H9BrO2 and a molecular weight of 253.09 g/mol. IUPAC name: prop-2-ynyl 4-bromo-3-methylbenzoate. InChIKey: CZAWRYBQXYETSL-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2 |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | prop-2-ynyl 4-bromo-3-methylbenzoate |
| InChIKey | CZAWRYBQXYETSL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)OCC#C)Br |
Computed by PubChem (NCBI)