CAS 1311264-98-8 is the registry number for 6-Bromospiro(chromane-2,1'-cyclopropan)-4-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromospiro[3H-chromene-2,1'-cyclopropane]-4-one (CAS 1311264-98-8) is a chemical compound with the molecular formula C11H9BrO2 and a molecular weight of 253.09 g/mol. IUPAC name: 6-bromospiro[3H-chromene-2,1'-cyclopropane]-4-one. InChIKey: QEABFRFBTSFXRE-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2 |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 6-bromospiro[3H-chromene-2,1'-cyclopropane]-4-one |
| InChIKey | QEABFRFBTSFXRE-UHFFFAOYSA-N |
| SMILES | C1CC12CC(=O)C3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)