Products 1221724-81-7
CAS 1221724-81-7 appears in our catalog under these names: Sodium 4-(propan-2-yl)-1,3-thiazole-2-carboxylate, 95%, Sodium 4-(propan-2-yl)-1,3-thiazole-2-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g.
Sodium 4-propan-2-yl-1,3-thiazole-2-carboxylate (CAS 1221724-81-7) is a chemical compound with the molecular formula C7H8NNaO2S and a molecular weight of 193.20 g/mol. IUPAC name: sodium 4-propan-2-yl-1,3-thiazole-2-carboxylate. InChIKey: UKZMRAIJGFRCSW-UHFFFAOYSA-M.
| Molecular formula | C7H8NNaO2S |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | sodium 4-propan-2-yl-1,3-thiazole-2-carboxylate |
| InChIKey | UKZMRAIJGFRCSW-UHFFFAOYSA-M |
| SMILES | CC(C)C1=CSC(=N1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)