CAS 1354959-53-7 appears in our catalog under these names: Sodium 2-(4-ethyl-1,3-thiazol-2-yl)acetate, 95%, Sodium 2-(4-ethyl-1,3-thiazol-2-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 2-(4-ethyl-1,3-thiazol-2-yl)acetate (CAS 1354959-53-7) is a chemical compound with the molecular formula C7H8NNaO2S and a molecular weight of 193.20 g/mol. IUPAC name: sodium 2-(4-ethyl-1,3-thiazol-2-yl)acetate. InChIKey: OLIHLPRGUZAGGV-UHFFFAOYSA-M.
| Molecular formula | C7H8NNaO2S |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | sodium 2-(4-ethyl-1,3-thiazol-2-yl)acetate |
| InChIKey | OLIHLPRGUZAGGV-UHFFFAOYSA-M |
| SMILES | CCC1=CSC(=N1)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)