CAS 2044796-55-4 appears in our catalog under these names: Sodium 2-methyl-2-(1,3-thiazol-2-yl)propanoate, 95%, Sodium 2-methyl-2-(1,3-thiazol-2-yl)propanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Sodium 2-methyl-2-(1,3-thiazol-2-yl)propanoate (CAS 2044796-55-4) is a chemical compound with the molecular formula C7H8NNaO2S and a molecular weight of 193.20 g/mol. IUPAC name: sodium 2-methyl-2-(1,3-thiazol-2-yl)propanoate. InChIKey: CQLZZLYXUNFNFT-UHFFFAOYSA-M.
| Molecular formula | C7H8NNaO2S |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | sodium 2-methyl-2-(1,3-thiazol-2-yl)propanoate |
| InChIKey | CQLZZLYXUNFNFT-UHFFFAOYSA-M |
| SMILES | CC(C)(C1=NC=CS1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)