CAS 1803585-21-8 appears in our catalog under these names: Sodium 4-(1,3-thiazol-2-yl)butanoate, 95%, Sodium 4-(1,3-thiazol-2-yl)butanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 4-(1,3-thiazol-2-yl)butanoate (CAS 1803585-21-8) is a chemical compound with the molecular formula C7H8NNaO2S and a molecular weight of 193.20 g/mol. IUPAC name: sodium 4-(1,3-thiazol-2-yl)butanoate. InChIKey: YWJPTCJPQWWBTC-UHFFFAOYSA-M.
| Molecular formula | C7H8NNaO2S |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | sodium 4-(1,3-thiazol-2-yl)butanoate |
| InChIKey | YWJPTCJPQWWBTC-UHFFFAOYSA-M |
| SMILES | C1=CSC(=N1)CCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)