CAS 1803593-26-1 appears in our catalog under these names: Sodium 2-(4-methyl-1,3-thiazol-2-yl)propanoate, 95%, Sodium 2-(4-methyl-1,3-thiazol-2-yl)propanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Sodium 2-(4-methyl-1,3-thiazol-2-yl)propanoate (CAS 1803593-26-1) is a chemical compound with the molecular formula C7H8NNaO2S and a molecular weight of 193.20 g/mol. IUPAC name: sodium 2-(4-methyl-1,3-thiazol-2-yl)propanoate. InChIKey: WHSDOQQZAJJYSC-UHFFFAOYSA-M.
| Molecular formula | C7H8NNaO2S |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | sodium 2-(4-methyl-1,3-thiazol-2-yl)propanoate |
| InChIKey | WHSDOQQZAJJYSC-UHFFFAOYSA-M |
| SMILES | CC1=CSC(=N1)C(C)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)