CAS 1240527-88-1 appears in our catalog under these names: Sodium 2-(dimethyl-1,3-thiazol-2-yl)acetate, 95%, Sodium 2-(dimethyl-1,3-thiazol-2-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Sodium 2-(4,5-dimethyl-1,3-thiazol-2-yl)acetate (CAS 1240527-88-1) is a chemical compound with the molecular formula C7H8NNaO2S and a molecular weight of 193.20 g/mol. IUPAC name: sodium 2-(4,5-dimethyl-1,3-thiazol-2-yl)acetate. InChIKey: ACMAJNIXAAVCIL-UHFFFAOYSA-M.
| Molecular formula | C7H8NNaO2S |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | sodium 2-(4,5-dimethyl-1,3-thiazol-2-yl)acetate |
| InChIKey | ACMAJNIXAAVCIL-UHFFFAOYSA-M |
| SMILES | CC1=C(SC(=N1)CC(=O)[O-])C.[Na+] |
Computed by PubChem (NCBI)