CAS 2098851-46-6 is the registry number for Sodium 4,6-dimethylpyridine-2-sulfinate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Sodium 4,6-dimethylpyridine-2-sulfinate (CAS 2098851-46-6) is a chemical compound with the molecular formula C7H8NNaO2S and a molecular weight of 193.20 g/mol. IUPAC name: sodium 4,6-dimethylpyridine-2-sulfinate. InChIKey: KQXCNQUPLKHKSF-UHFFFAOYSA-M.
| Molecular formula | C7H8NNaO2S |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | sodium 4,6-dimethylpyridine-2-sulfinate |
| InChIKey | KQXCNQUPLKHKSF-UHFFFAOYSA-M |
| SMILES | CC1=CC(=NC(=C1)S(=O)[O-])C.[Na+] |
Computed by PubChem (NCBI)