Products 1221725-97-8

CAS 1221725-97-8 appears in our catalog under these names: 3,5-Difluoro-n-(2-methylpropyl)aniline hydrochloride, 95%, 3,5-Difluoro-N-(2-methylpropyl)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.

Structural formula: {0} (CAS {1})

3,5-difluoro-N-(2-methylpropyl)aniline;hydrochloride (CAS 1221725-97-8) is a chemical compound with the molecular formula C10H14ClF2N and a molecular weight of 221.67 g/mol. IUPAC name: 3,5-difluoro-N-(2-methylpropyl)aniline;hydrochloride. InChIKey: KKHLQQYJBXRPGE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClF2N
Molecular weight221.67 g/mol
IUPAC name3,5-difluoro-N-(2-methylpropyl)aniline;hydrochloride
InChIKeyKKHLQQYJBXRPGE-UHFFFAOYSA-N
SMILESCC(C)CNC1=CC(=CC(=C1)F)F.Cl

Computed by PubChem (NCBI)