CAS 2138083-36-8 is the registry number for 1,1-Difluoro-2-methyl-3-phenylpropan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,1-difluoro-2-methyl-3-phenylpropan-2-amine;hydrochloride (CAS 2138083-36-8) is a chemical compound with the molecular formula C10H14ClF2N and a molecular weight of 221.67 g/mol. IUPAC name: 1,1-difluoro-2-methyl-3-phenylpropan-2-amine;hydrochloride. InChIKey: XNRYJKBSGJERLI-UHFFFAOYSA-N.
| Molecular formula | C10H14ClF2N |
|---|---|
| Molecular weight | 221.67 g/mol |
| IUPAC name | 1,1-difluoro-2-methyl-3-phenylpropan-2-amine;hydrochloride |
| InChIKey | XNRYJKBSGJERLI-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=CC=C1)(C(F)F)N.Cl |
Computed by PubChem (NCBI)