CAS 868049-70-1 is the registry number for 1-(2,4-Difluorophenyl)-2-methylpropan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,4-difluorophenyl)-2-methylpropan-2-amine;hydrochloride (CAS 868049-70-1) is a chemical compound with the molecular formula C10H14ClF2N and a molecular weight of 221.67 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-2-methylpropan-2-amine;hydrochloride. InChIKey: FHEPTXHFNCBFOP-UHFFFAOYSA-N.
| Molecular formula | C10H14ClF2N |
|---|---|
| Molecular weight | 221.67 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-2-methylpropan-2-amine;hydrochloride |
| InChIKey | FHEPTXHFNCBFOP-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=C(C=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)