CAS 1258652-04-8 appears in our catalog under these names: 4-(3,4-Difluorophenyl)butan-2-amine hydrochloride, 95%, 4-(3,4-Difluorophenyl)butan-2-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(3,4-difluorophenyl)butan-2-amine;hydrochloride (CAS 1258652-04-8) is a chemical compound with the molecular formula C10H14ClF2N and a molecular weight of 221.67 g/mol. IUPAC name: 4-(3,4-difluorophenyl)butan-2-amine;hydrochloride. InChIKey: LBAGZASJLNIHPI-UHFFFAOYSA-N.
| Molecular formula | C10H14ClF2N |
|---|---|
| Molecular weight | 221.67 g/mol |
| IUPAC name | 4-(3,4-difluorophenyl)butan-2-amine;hydrochloride |
| InChIKey | LBAGZASJLNIHPI-UHFFFAOYSA-N |
| SMILES | CC(CCC1=CC(=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)