CAS 2230799-93-4 is the registry number for 3,3-Difluoro-2-phenylbutan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,3-difluoro-2-phenylbutan-1-amine;hydrochloride (CAS 2230799-93-4) is a chemical compound with the molecular formula C10H14ClF2N and a molecular weight of 221.67 g/mol. IUPAC name: 3,3-difluoro-2-phenylbutan-1-amine;hydrochloride. InChIKey: UOSLJMWJEUHILZ-UHFFFAOYSA-N.
| Molecular formula | C10H14ClF2N |
|---|---|
| Molecular weight | 221.67 g/mol |
| IUPAC name | 3,3-difluoro-2-phenylbutan-1-amine;hydrochloride |
| InChIKey | UOSLJMWJEUHILZ-UHFFFAOYSA-N |
| SMILES | CC(C(CN)C1=CC=CC=C1)(F)F.Cl |
Computed by PubChem (NCBI)