CAS 2435608-28-7 appears in our catalog under these names: 2-(2,4-Dimethylphenyl)-2,2-difluoroethanamine Hydrochloride, 2-(2,4-Dimethylphenyl)-2,2-difluoroethanamine hydrochloride, 95%. Offered by: TRC, AmBeed. Available pack sizes: 1g, 5g, 50mg.
2-(2,4-dimethylphenyl)-2,2-difluoroethanamine;hydrochloride (CAS 2435608-28-7) is a chemical compound with the molecular formula C10H14ClF2N and a molecular weight of 221.67 g/mol. IUPAC name: 2-(2,4-dimethylphenyl)-2,2-difluoroethanamine;hydrochloride. InChIKey: SQAPETYKMRAODI-UHFFFAOYSA-N.
| Molecular formula | C10H14ClF2N |
|---|---|
| Molecular weight | 221.67 g/mol |
| IUPAC name | 2-(2,4-dimethylphenyl)-2,2-difluoroethanamine;hydrochloride |
| InChIKey | SQAPETYKMRAODI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(CN)(F)F)C.Cl |
Computed by PubChem (NCBI)