CAS 2883825-74-7 is the registry number for (S)-1-(3-(Difluoromethyl)-2-methylphenyl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[3-(difluoromethyl)-2-methylphenyl]ethanamine;hydrochloride (CAS 2883825-74-7) is a chemical compound with the molecular formula C10H14ClF2N and a molecular weight of 221.67 g/mol. IUPAC name: (1S)-1-[3-(difluoromethyl)-2-methylphenyl]ethanamine;hydrochloride. InChIKey: OZBLIJWTPQRCAS-FJXQXJEOSA-N.
| Molecular formula | C10H14ClF2N |
|---|---|
| Molecular weight | 221.67 g/mol |
| IUPAC name | (1S)-1-[3-(difluoromethyl)-2-methylphenyl]ethanamine;hydrochloride |
| InChIKey | OZBLIJWTPQRCAS-FJXQXJEOSA-N |
| SMILES | CC1=C(C=CC=C1C(F)F)[C@H](C)N.Cl |
Computed by PubChem (NCBI)