Products 1221791-59-8
CAS 1221791-59-8 is the registry number for 3-Cyano-4,6-dimethylpicolinic acid, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
3-cyano-4,6-dimethylpyridine-2-carboxylic acid (CAS 1221791-59-8) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 3-cyano-4,6-dimethylpyridine-2-carboxylic acid. InChIKey: DHRWDLAYEMNOAZ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 3-cyano-4,6-dimethylpyridine-2-carboxylic acid |
| InChIKey | DHRWDLAYEMNOAZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C#N)C(=O)O)C |
Computed by PubChem (NCBI)