Products 1222185-12-7
CAS 1222185-12-7 appears in our catalog under these names: Dimethyl 3-bromopyridine-2,4-dicarboxylate, 95%, Dimethyl 3-bromopyridine-2,4-dicarboxylate, 95+%, Dimethyl 3–bromopyridine–2，4–dicarboxylate, Dimethyl 3-bromopyridine-2,4-dicarboxylate. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 5g, 1g, 0,5g, 50mg.
Dimethyl 3-bromopyridine-2,4-dicarboxylate (CAS 1222185-12-7) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: dimethyl 3-bromopyridine-2,4-dicarboxylate. InChIKey: HFNZJWNHJISTPX-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | dimethyl 3-bromopyridine-2,4-dicarboxylate |
| InChIKey | HFNZJWNHJISTPX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)