Products 1222634-06-1

CAS 1222634-06-1 is the registry number for N-phenyl-[1,1':4',1''-terphenyl]-3-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

N-phenyl-3-(4-phenylphenyl)aniline (CAS 1222634-06-1) is a chemical compound with the molecular formula C24H19N and a molecular weight of 321.4 g/mol. IUPAC name: N-phenyl-3-(4-phenylphenyl)aniline. InChIKey: VEXVJXWZQXXEPR-UHFFFAOYSA-N.

Identity
Molecular formulaC24H19N
Molecular weight321.4 g/mol
IUPAC nameN-phenyl-3-(4-phenylphenyl)aniline
InChIKeyVEXVJXWZQXXEPR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC(=CC=C3)NC4=CC=CC=C4

Computed by PubChem (NCBI)

Synonyms: starbld0015673