Products 1226149-25-2
CAS 1226149-25-2 is the registry number for 2-(Furan-2-yl)-5-methyloxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(furan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid (CAS 1226149-25-2) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 2-(furan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid. InChIKey: DIQXXEMZNWFONG-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 2-(furan-2-yl)-5-methyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | DIQXXEMZNWFONG-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CO2)C(=O)O |
Computed by PubChem (NCBI)