Products 1227268-77-0
CAS 1227268-77-0 appears in our catalog under these names: 3-Methylimidazo[1,2-a]pyridine-2-carboxylic acid, 95%, 3-Methylimidazo[1,2-a]pyridine-2-carboxylic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
3-methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS 1227268-77-0) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 3-methylimidazo[1,2-a]pyridine-2-carboxylic acid. InChIKey: ICTPQPHRSOIPGU-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 3-methylimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChIKey | ICTPQPHRSOIPGU-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2N1C=CC=C2)C(=O)O |
Computed by PubChem (NCBI)