Products 1227269-44-4
CAS 1227269-44-4 appears in our catalog under these names: 5-Bromo-1H-indole-6-carboxylic acid, 97%, 97%, 5-Bromo-1H-indole-6-carboxylic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
5-bromo-1H-indole-6-carboxylic acid (CAS 1227269-44-4) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 5-bromo-1H-indole-6-carboxylic acid. InChIKey: KZDAYIRBVQRKRT-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 5-bromo-1H-indole-6-carboxylic acid |
| InChIKey | KZDAYIRBVQRKRT-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=C(C=C21)Br)C(=O)O |
Computed by PubChem (NCBI)