CAS 1227271-01-3 appears in our catalog under these names: 5-Methoxy-1H-indole-6-carboxylic acid 98%, 5-Methoxy-1H-indole-6-carboxylic acid, 98%, 98%, 5-METHOXY-1H-INDOLE-6-CARBOXYLIC ACID, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-methoxy-1H-indole-6-carboxylic acid (CAS 1227271-01-3) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 5-methoxy-1H-indole-6-carboxylic acid. InChIKey: IWRMGXTZKKOOIO-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 5-methoxy-1H-indole-6-carboxylic acid |
| InChIKey | IWRMGXTZKKOOIO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CN2)C(=O)O |
Computed by PubChem (NCBI)