CAS 1227465-79-3 appears in our catalog under these names: 7-Fluoro-2-oxo-1,2-dihydroquinoline-4-carboxylic acid, 95%, 7-Fluoro-2-oxo-1,2-dihydroquinoline-4-carboxylic acid, 95+%, 7-Fluoro-2-oxo-1,2-dihydroquinoline-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 10g.
7-fluoro-2-oxo-1H-quinoline-4-carboxylic acid (CAS 1227465-79-3) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 7-fluoro-2-oxo-1H-quinoline-4-carboxylic acid. InChIKey: JNJDJHAPAYHLSZ-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 7-fluoro-2-oxo-1H-quinoline-4-carboxylic acid |
| InChIKey | JNJDJHAPAYHLSZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=O)C=C2C(=O)O |
Computed by PubChem (NCBI)