Products 1227574-99-3
CAS 1227574-99-3 appears in our catalog under these names: 2–Fluoro–5–(trifluoromethyl)isonicotinic acid, 2-Fluoro-5-(trifluoromethyl)isonicotinic acid 97%, 2-Fluoro-5-(trifluoromethyl)isonicotinic acid, 97%, 97%, 2-FLUORO-5-(TRIFLUOROMETHYL)ISONICOTINIC ACID, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-fluoro-5-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 1227574-99-3) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: BDDFVXARBRBJDB-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 2-fluoro-5-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | BDDFVXARBRBJDB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)