Products 1227592-97-3
CAS 1227592-97-3 is the registry number for 2-(2,6-Dibromopyridin-4-yl)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dibromo-4-pyridinyl)acetic acid (CAS 1227592-97-3) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 2-(2,6-dibromo-4-pyridinyl)acetic acid. InChIKey: APNLBEGJMNCTSO-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 2-(2,6-dibromo-4-pyridinyl)acetic acid |
| InChIKey | APNLBEGJMNCTSO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Br)Br)CC(=O)O |
Computed by PubChem (NCBI)