Products 122839-49-0
CAS 122839-49-0 is the registry number for (R)-2-amino-3-(2,4-difluorophenyl)propanoic acid hydrochloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-3-(2,4-difluorophenyl)propanoic acid;hydrochloride (CAS 122839-49-0) is a chemical compound with the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. IUPAC name: (2R)-2-amino-3-(2,4-difluorophenyl)propanoic acid;hydrochloride. InChIKey: BRRUTOUCOMNLQX-DDWIOCJRSA-N.
| Molecular formula | C9H10ClF2NO2 |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,4-difluorophenyl)propanoic acid;hydrochloride |
| InChIKey | BRRUTOUCOMNLQX-DDWIOCJRSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)