Products 2375274-51-2

CAS 2375274-51-2 is the registry number for 3-Amino-2-(2,5-difluorophenyl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-amino-2-(2,5-difluorophenyl)propanoic acid;hydrochloride (CAS 2375274-51-2) is a chemical compound with the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. IUPAC name: 3-amino-2-(2,5-difluorophenyl)propanoic acid;hydrochloride. InChIKey: QBBJUYAUAWZLMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClF2NO2
Molecular weight237.63 g/mol
IUPAC name3-amino-2-(2,5-difluorophenyl)propanoic acid;hydrochloride
InChIKeyQBBJUYAUAWZLMZ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)C(CN)C(=O)O)F.Cl

Computed by PubChem (NCBI)