CAS 1909316-10-4 is the registry number for ((2,2-Difluoro-1,3-dioxaindan-5-yl)methyl)(methyl)amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-methylmethanamine;hydrochloride (CAS 1909316-10-4) is a chemical compound with the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. IUPAC name: 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-methylmethanamine;hydrochloride. InChIKey: RCXGQSTVYIJVEK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO2 |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-methylmethanamine;hydrochloride |
| InChIKey | RCXGQSTVYIJVEK-UHFFFAOYSA-N |
| SMILES | CNCC1=CC2=C(C=C1)OC(O2)(F)F.Cl |
Computed by PubChem (NCBI)