CAS 2270913-80-7 is the registry number for (2,2-Difluoro-benzo[1,3]dioxol-4-ylmethyl)-methyl-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-methylmethanamine;hydrochloride (CAS 2270913-80-7) is a chemical compound with the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. IUPAC name: 1-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-methylmethanamine;hydrochloride. InChIKey: IVHNCFVXEQBPBL-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO2 |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | 1-(2,2-difluoro-1,3-benzodioxol-4-yl)-N-methylmethanamine;hydrochloride |
| InChIKey | IVHNCFVXEQBPBL-UHFFFAOYSA-N |
| SMILES | CNCC1=C2C(=CC=C1)OC(O2)(F)F.Cl |
Computed by PubChem (NCBI)