CAS 1251923-42-8 is the registry number for Methyl 2-amino-2-(2,5-difluorophenyl)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Methyl 2-amino-2-(2,5-difluorophenyl)acetate;hydrochloride (CAS 1251923-42-8) is a chemical compound with the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. IUPAC name: methyl 2-amino-2-(2,5-difluorophenyl)acetate;hydrochloride. InChIKey: KTAPVPAKDYEIPR-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO2 |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | methyl 2-amino-2-(2,5-difluorophenyl)acetate;hydrochloride |
| InChIKey | KTAPVPAKDYEIPR-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=CC(=C1)F)F)N.Cl |
Computed by PubChem (NCBI)