Products 1251923-42-8

CAS 1251923-42-8 is the registry number for Methyl 2-amino-2-(2,5-difluorophenyl)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

Methyl 2-amino-2-(2,5-difluorophenyl)acetate;hydrochloride (CAS 1251923-42-8) is a chemical compound with the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. IUPAC name: methyl 2-amino-2-(2,5-difluorophenyl)acetate;hydrochloride. InChIKey: KTAPVPAKDYEIPR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClF2NO2
Molecular weight237.63 g/mol
IUPAC namemethyl 2-amino-2-(2,5-difluorophenyl)acetate;hydrochloride
InChIKeyKTAPVPAKDYEIPR-UHFFFAOYSA-N
SMILESCOC(=O)C(C1=C(C=CC(=C1)F)F)N.Cl

Computed by PubChem (NCBI)