CAS 2135332-32-8 appears in our catalog under these names: 1-(2,2-DIFLUOROBENZO(D)(1,3)DIOXOL-4-YL)ETHAN-1-AMINE HCL, 95%, 1-(2,2-Difluorobenzo[d][1,3]dioxol-4-yl)ethan-1-amine hydrochloride, 98%, 98%, 1-(2,2-DIFLUOROBENZO[D][1,3]DIOXOL-4-YL)ETHAN-1-AMINE HCL, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
1-(2,2-difluoro-1,3-benzodioxol-4-yl)ethanamine;hydrochloride (CAS 2135332-32-8) is a chemical compound with the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. IUPAC name: 1-(2,2-difluoro-1,3-benzodioxol-4-yl)ethanamine;hydrochloride. InChIKey: DUXCNXPNMSAOOM-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO2 |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | 1-(2,2-difluoro-1,3-benzodioxol-4-yl)ethanamine;hydrochloride |
| InChIKey | DUXCNXPNMSAOOM-UHFFFAOYSA-N |
| SMILES | CC(C1=C2C(=CC=C1)OC(O2)(F)F)N.Cl |
Computed by PubChem (NCBI)