CAS 1958125-88-6 appears in our catalog under these names: (R)-Methyl 2-amino-2-(2,4-difluorophenyl)acetate hydrochloride, 95%, (R)–Methyl 2–amino–2–(2,4–difluorophenyl)acetate hydrochloride, (R)-Methyl 2-amino-2-(2,4-difluorophenyl)acetate hydrochloride, 97%, 97%, METHYL (2R)-2-AMINO-2-(2,4-DIFLUOROPHENYL)ACETATE HCL, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg.
Methyl (2R)-2-amino-2-(2,4-difluorophenyl)acetate;hydrochloride (CAS 1958125-88-6) is a chemical compound with the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. IUPAC name: methyl (2R)-2-amino-2-(2,4-difluorophenyl)acetate;hydrochloride. InChIKey: JGIXPMPFXKDMQH-DDWIOCJRSA-N.
| Molecular formula | C9H10ClF2NO2 |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(2,4-difluorophenyl)acetate;hydrochloride |
| InChIKey | JGIXPMPFXKDMQH-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1=C(C=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)