Products 1228552-82-6

CAS 1228552-82-6 is the registry number for 3-(3-Fluorophenoxy)pyrazine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(3-fluorophenoxy)pyrazine-2-carboxylic acid (CAS 1228552-82-6) is a chemical compound with the molecular formula C11H7FN2O3 and a molecular weight of 234.18 g/mol. IUPAC name: 3-(3-fluorophenoxy)pyrazine-2-carboxylic acid. InChIKey: XFTJASGXXRSKRG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7FN2O3
Molecular weight234.18 g/mol
IUPAC name3-(3-fluorophenoxy)pyrazine-2-carboxylic acid
InChIKeyXFTJASGXXRSKRG-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)F)OC2=NC=CN=C2C(=O)O

Computed by PubChem (NCBI)