CAS 874401-03-3 appears in our catalog under these names: 1-(4-Fluorophenyl)-4-oxopyridazine-3-carboxylic acid, 1-(4-Fluorophenyl)-4-oxo-1,4-dihydropyridazine-3-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 5g, 10g, 1g, 250mg.
1-(4-fluorophenyl)-4-oxopyridazine-3-carboxylic acid (CAS 874401-03-3) is a chemical compound with the molecular formula C11H7FN2O3 and a molecular weight of 234.18 g/mol. IUPAC name: 1-(4-fluorophenyl)-4-oxopyridazine-3-carboxylic acid. InChIKey: CKMATXNXEMOXBH-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2O3 |
|---|---|
| Molecular weight | 234.18 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-4-oxopyridazine-3-carboxylic acid |
| InChIKey | CKMATXNXEMOXBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=CC(=O)C(=N2)C(=O)O)F |
Computed by PubChem (NCBI)