CAS 803700-29-0 appears in our catalog under these names: 3-(3-Fluoro-5-nitrophenoxy)pyridine, 95%, 3–(3–Fluoro–5–nitrophenoxy)pyridine. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 250mg.
3-(3-fluoro-5-nitrophenoxy)pyridine (CAS 803700-29-0) is a chemical compound with the molecular formula C11H7FN2O3 and a molecular weight of 234.18 g/mol. IUPAC name: 3-(3-fluoro-5-nitrophenoxy)pyridine. InChIKey: DBJJZYUJIVEGND-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2O3 |
|---|---|
| Molecular weight | 234.18 g/mol |
| IUPAC name | 3-(3-fluoro-5-nitrophenoxy)pyridine |
| InChIKey | DBJJZYUJIVEGND-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)OC2=CC(=CC(=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)