Products 2169920-30-1

CAS 2169920-30-1 is the registry number for 5-Fluoro-2-(pyrimidin-5-yloxy)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-fluoro-2-pyrimidin-5-yloxybenzoic acid (CAS 2169920-30-1) is a chemical compound with the molecular formula C11H7FN2O3 and a molecular weight of 234.18 g/mol. IUPAC name: 5-fluoro-2-pyrimidin-5-yloxybenzoic acid. InChIKey: SLJZCMWIMUTTNR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7FN2O3
Molecular weight234.18 g/mol
IUPAC name5-fluoro-2-pyrimidin-5-yloxybenzoic acid
InChIKeySLJZCMWIMUTTNR-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)C(=O)O)OC2=CN=CN=C2

Computed by PubChem (NCBI)