CAS 147143-58-6 is the registry number for 2-(4-Fluorophenoxy)-3-nitropyridine, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
2-(4-fluorophenoxy)-3-nitropyridine (CAS 147143-58-6) is a chemical compound with the molecular formula C11H7FN2O3 and a molecular weight of 234.18 g/mol. IUPAC name: 2-(4-fluorophenoxy)-3-nitropyridine. InChIKey: CCUGBHTWDHSEOA-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2O3 |
|---|---|
| Molecular weight | 234.18 g/mol |
| IUPAC name | 2-(4-fluorophenoxy)-3-nitropyridine |
| InChIKey | CCUGBHTWDHSEOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OC2=CC=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)