Products 1267461-58-4

CAS 1267461-58-4 is the registry number for 2-(4-Fluorophenyl)-6-oxo-1,6-dihydropyrimidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-fluorophenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid (CAS 1267461-58-4) is a chemical compound with the molecular formula C11H7FN2O3 and a molecular weight of 234.18 g/mol. IUPAC name: 2-(4-fluorophenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid. InChIKey: IJSQPQSKJVHBFO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7FN2O3
Molecular weight234.18 g/mol
IUPAC name2-(4-fluorophenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid
InChIKeyIJSQPQSKJVHBFO-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NC(=CC(=O)N2)C(=O)O)F

Computed by PubChem (NCBI)