CAS 926238-43-9 is the registry number for 1-(4-Fluorophenyl)-6-oxo-1,6-dihydropyridazine-3-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1-(4-fluorophenyl)-6-oxopyridazine-3-carboxylic acid (CAS 926238-43-9) is a chemical compound with the molecular formula C11H7FN2O3 and a molecular weight of 234.18 g/mol. IUPAC name: 1-(4-fluorophenyl)-6-oxopyridazine-3-carboxylic acid. InChIKey: VNHLEFHDAHNXIU-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2O3 |
|---|---|
| Molecular weight | 234.18 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-6-oxopyridazine-3-carboxylic acid |
| InChIKey | VNHLEFHDAHNXIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC(=N2)C(=O)O)F |
Computed by PubChem (NCBI)