CAS 1228570-43-1 appears in our catalog under these names: Boc-(S)-2-amino-2-(3-bromophenyl)acetic acid, BOC-(S)-2-AMINO-2-(3-BROMOPHENYL)ACETIC ACID, 95%, 95%, (S)-2-(3-Bromophenyl)-2-((tert-butoxycarbonyl)amino)acetic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 250mg, 1g.
(2S)-2-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1228570-43-1) is a chemical compound with the molecular formula C13H16BrNO4 and a molecular weight of 330.17 g/mol. IUPAC name: (2S)-2-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ZHAAYALRXSZQLX-JTQLQIEISA-N.
| Molecular formula | C13H16BrNO4 |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | (2S)-2-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ZHAAYALRXSZQLX-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC(=CC=C1)Br)C(=O)O |
Computed by PubChem (NCBI)