Products 1228600-91-6
CAS 1228600-91-6 appears in our catalog under these names: 2-Methoxy-7,8-dihydro-1,6-naphthyridin-5(6h)-one, 95%, 2-Methoxy-7,8-dihydro-1,6-naphthyridin-5(6H)-one, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-methoxy-7,8-dihydro-6H-1,6-naphthyridin-5-one (CAS 1228600-91-6) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 2-methoxy-7,8-dihydro-6H-1,6-naphthyridin-5-one. InChIKey: ULDDNWLSWDLLTO-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 2-methoxy-7,8-dihydro-6H-1,6-naphthyridin-5-one |
| InChIKey | ULDDNWLSWDLLTO-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)C(=O)NCC2 |
Computed by PubChem (NCBI)