Products 123053-42-9

CAS 123053-42-9 appears in our catalog under these names: (2S)-Azepane-2-carboxylic acid hydrochloride, 97%, (S)-Azepane-2-carboxylic acid hydrochloride, 97%, (2S)-Azepane-2-carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

(2S)-azepane-2-carboxylic acid;hydrochloride (CAS 123053-42-9) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (2S)-azepane-2-carboxylic acid;hydrochloride. InChIKey: ZLLUTYACBSEHCT-RGMNGODLSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC name(2S)-azepane-2-carboxylic acid;hydrochloride
InChIKeyZLLUTYACBSEHCT-RGMNGODLSA-N
SMILESC1CC[C@H](NCC1)C(=O)O.Cl

Computed by PubChem (NCBI)