CAS 2243501-33-7 appears in our catalog under these names: (R)-Azepane-2-carboxylic acid hydrochloride, 95%, (2R)-Azepane-2-carboxylic acid hydrochloride, (R)-Azepane-2-carboxylic acid hydrochloride, 97%, 97%, (2R)-AZEPANE-2-CARBOXYLIC ACID HYDROCHLORIDE, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg, 500mg.
(2R)-azepane-2-carboxylic acid;hydrochloride (CAS 2243501-33-7) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (2R)-azepane-2-carboxylic acid;hydrochloride. InChIKey: ZLLUTYACBSEHCT-FYZOBXCZSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (2R)-azepane-2-carboxylic acid;hydrochloride |
| InChIKey | ZLLUTYACBSEHCT-FYZOBXCZSA-N |
| SMILES | C1CC[C@@H](NCC1)C(=O)O.Cl |
Computed by PubChem (NCBI)