Products 5227-52-1

CAS 5227-52-1 appears in our catalog under these names: Azepane-2-carboxylic acid hydrochloride, 95%, Azepane-2-carboxylic acid hydrochloride, 98%, Azepane-2-carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 10g, 5g, 0,5g.

Structural formula: {0} (CAS {1})

Azepane-2-carboxylic acid;hydrochloride (CAS 5227-52-1) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: azepane-2-carboxylic acid;hydrochloride. InChIKey: ZLLUTYACBSEHCT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC nameazepane-2-carboxylic acid;hydrochloride
InChIKeyZLLUTYACBSEHCT-UHFFFAOYSA-N
SMILESC1CCC(NCC1)C(=O)O.Cl

Computed by PubChem (NCBI)