CAS 1231709-25-3 is the registry number for H-alpha-Me-D-Asp(tBu)-OH. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
(2R)-2-amino-2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 1231709-25-3) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2R)-2-amino-2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: VIQZVYPYYUPDQY-SECBINFHSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2R)-2-amino-2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | VIQZVYPYYUPDQY-SECBINFHSA-N |
| SMILES | C[C@@](CC(=O)OC(C)(C)C)(C(=O)O)N |
Computed by PubChem (NCBI)