Products 1232424-44-0
CAS 1232424-44-0 appears in our catalog under these names: Methyl 4-bromo-3-cyanobenzoate, 97%, Benzoic acid, 4-bromo-3-cyano-, methyl ester, 98%, 98%, METHYL 4-BROMO-3-CYANOBENZOATE, 98%, Methyl 4-bromo-3-cyanobenzoate, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg.
Methyl 4-bromo-3-cyanobenzoate (CAS 1232424-44-0) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: methyl 4-bromo-3-cyanobenzoate. InChIKey: OAXDJXKMGGXRNZ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | methyl 4-bromo-3-cyanobenzoate |
| InChIKey | OAXDJXKMGGXRNZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Br)C#N |
Computed by PubChem (NCBI)