Products 1232801-51-2

CAS 1232801-51-2 is the registry number for 2-(2-Chlorophenoxy)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2-(2-chlorophenoxy)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1232801-51-2) is a chemical compound with the molecular formula C11H8ClNO3S and a molecular weight of 269.70 g/mol. IUPAC name: 2-(2-chlorophenoxy)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: JFTPBEZDYSGECQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8ClNO3S
Molecular weight269.70 g/mol
IUPAC name2-(2-chlorophenoxy)-4-methyl-1,3-thiazole-5-carboxylic acid
InChIKeyJFTPBEZDYSGECQ-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)OC2=CC=CC=C2Cl)C(=O)O

Computed by PubChem (NCBI)