CAS 216985-67-0 appears in our catalog under these names: [(3-Chloro-benzo[b]thiophene-2-carbonyl)-amino]-acetic acid, 95%, [(3-Chloro-benzo[b]thiophene-2-carbonyl)-amino]-acetic acid, 98%, 98%, 2-[(3-chloro-1-benzothiophen-2-yl)formamido]acetic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetic acid (CAS 216985-67-0) is a chemical compound with the molecular formula C11H8ClNO3S and a molecular weight of 269.70 g/mol. IUPAC name: 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetic acid. InChIKey: LLLITEMJLQKDAX-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3S |
|---|---|
| Molecular weight | 269.70 g/mol |
| IUPAC name | 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetic acid |
| InChIKey | LLLITEMJLQKDAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)C(=O)NCC(=O)O)Cl |
Computed by PubChem (NCBI)